C16H17F3OSi — CID 56933855
[dimethyl(phenyl)silyl]-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 56933855) has the molecular formula C16H17F3OSi and a molecular weight of 310.39 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl]-[4-(trifluoromethyl)phenyl]methanol.
| Compound Name | [dimethyl(phenyl)silyl]-[4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 56933855 |
| Molecular Formula | C16H17F3OSi |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [dimethyl(phenyl)silyl]-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | C[Si](C)(c1ccccc1)C(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3OSi/c1-21(2,14-6-4-3-5-7-14)15(20)12-8-10-13(11-9-12)16(17,18)19/h3-11,15,20H,1-2H3 |
| InChIKey | FQKSWXSBXDKSKD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|