C21H27F3O2Si2 — CID 16663926
(1S,2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]cyclobutane-1,2-diol (PubChem CID 16663926) has the molecular formula C21H27F3O2Si2 and a molecular weight of 424.61 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]cyclobutane-1,2-diol.
| Compound Name | (1S,2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]cyclobutane-1,2-diol |
|---|---|
| PubChem CID | 16663926 |
| Molecular Formula | C21H27F3O2Si2 |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (1S,2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]cyclobutane-1,2-diol |
| SMILES | C[Si](C)(c1ccc(C(F)(F)F)cc1)[C@@H]1[C@@H](O)[C@@H](O)[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H27F3O2Si2/c1-27(2,15-8-6-5-7-9-15)19-17(25)18(26)20(19)28(3,4)16-12-10-14(11-13-16)21(22,23)24/h5-13,17-20,25-26H,1-4H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | JFOZJJITLLTKCF-FUMNGEBKSA-N |
| XLogP | 3.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|