C18H19F3Si — CID 71663437
dimethyl-phenyl-[(1R)-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]silane (PubChem CID 71663437) has the molecular formula C18H19F3Si and a molecular weight of 320.43 g/mol. Its IUPAC name is dimethyl-phenyl-[(1R)-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]silane.
| Compound Name | dimethyl-phenyl-[(1R)-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]silane |
|---|---|
| PubChem CID | 71663437 |
| Molecular Formula | C18H19F3Si |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | dimethyl-phenyl-[(1R)-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]silane |
| SMILES | C=C[C@H](c1ccc(C(F)(F)F)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H19F3Si/c1-4-17(22(2,3)16-8-6-5-7-9-16)14-10-12-15(13-11-14)18(19,20)21/h4-13,17H,1H2,2-3H3/t17-/m1/s1 |
| InChIKey | FZMBCGKXZGMFRX-QGZVFWFLSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|