C22H25F3OSi — CID 135060755
(Z,6R)-6-[dimethyl(phenyl)silyl]-4-methyl-6-[4-(trifluoromethyl)phenyl]hex-4-en-2-one (PubChem CID 135060755) has the molecular formula C22H25F3OSi and a molecular weight of 390.52 g/mol. Its IUPAC name is (Z,6R)-6-[dimethyl(phenyl)silyl]-4-methyl-6-[4-(trifluoromethyl)phenyl]hex-4-en-2-one.
| Compound Name | (Z,6R)-6-[dimethyl(phenyl)silyl]-4-methyl-6-[4-(trifluoromethyl)phenyl]hex-4-en-2-one |
|---|---|
| PubChem CID | 135060755 |
| Molecular Formula | C22H25F3OSi |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (Z,6R)-6-[dimethyl(phenyl)silyl]-4-methyl-6-[4-(trifluoromethyl)phenyl]hex-4-en-2-one |
| SMILES | CC(=O)C/C(C)=C\[C@H](c1ccc(C(F)(F)F)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H25F3OSi/c1-16(14-17(2)26)15-21(27(3,4)20-8-6-5-7-9-20)18-10-12-19(13-11-18)22(23,24)25/h5-13,15,21H,14H2,1-4H3/b16-15-/t21-/m1/s1 |
| InChIKey | SCOHFSBLJJERBD-XPNMMBGKSA-N |
| XLogP | 5.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|