C19H21F3OSi — CID 16757036
(4R)-4-[dimethyl(phenyl)silyl]-4-[4-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 16757036) has the molecular formula C19H21F3OSi and a molecular weight of 350.46 g/mol. Its IUPAC name is (4R)-4-[dimethyl(phenyl)silyl]-4-[4-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | (4R)-4-[dimethyl(phenyl)silyl]-4-[4-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 16757036 |
| Molecular Formula | C19H21F3OSi |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (4R)-4-[dimethyl(phenyl)silyl]-4-[4-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | CC(=O)C[C@H](c1ccc(C(F)(F)F)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H21F3OSi/c1-14(23)13-18(24(2,3)17-7-5-4-6-8-17)15-9-11-16(12-10-15)19(20,21)22/h4-12,18H,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | PADGNPIGIUEKGA-GOSISDBHSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|