C14H20F2O4S — CID 171377662
(E)-1,1-difluoro-2-methyl-6-phenylhex-3-en-1-ol;methanesulfonic acid (PubChem CID 171377662) has the molecular formula C14H20F2O4S and a molecular weight of 322.37 g/mol. Its IUPAC name is (E)-1,1-difluoro-2-methyl-6-phenylhex-3-en-1-ol;methanesulfonic acid.
| Compound Name | (E)-1,1-difluoro-2-methyl-6-phenylhex-3-en-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 171377662 |
| Molecular Formula | C14H20F2O4S |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (E)-1,1-difluoro-2-methyl-6-phenylhex-3-en-1-ol;methanesulfonic acid |
| SMILES | CC(/C=C/CCc1ccccc1)C(O)(F)F.CS(=O)(=O)O |
| InChI | InChI=1S/C13H16F2O.CH4O3S/c1-11(13(14,15)16)7-5-6-10-12-8-3-2-4-9-12;1-5(2,3)4/h2-5,7-9,11,16H,6,10H2,1H3;1H3,(H,2,3,4)/b7-5+; |
| InChIKey | RKVAPUZJYZBBPR-GZOLSCHFSA-N |
| XLogP | 2.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|