C16H26F2O2Si — CID 175109770
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,5-difluorophenyl)butan-1-ol (PubChem CID 175109770) has the molecular formula C16H26F2O2Si and a molecular weight of 316.46 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,5-difluorophenyl)butan-1-ol.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,5-difluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 175109770 |
| Molecular Formula | C16H26F2O2Si |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,5-difluorophenyl)butan-1-ol |
| SMILES | C[C@H](CC(O)c1cc(F)ccc1F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26F2O2Si/c1-11(20-21(5,6)16(2,3)4)9-15(19)13-10-12(17)7-8-14(13)18/h7-8,10-11,15,19H,9H2,1-6H3/t11-,15?/m1/s1 |
| InChIKey | LHUBUGVAOJWQJC-ZRKZCGFPSA-N |
| XLogP | 4.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|