C14H20F2O — CID 114200459
1-(2,5-difluorophenyl)-3,5-dimethylhexan-1-ol (PubChem CID 114200459) has the molecular formula C14H20F2O and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3,5-dimethylhexan-1-ol.
| Compound Name | 1-(2,5-difluorophenyl)-3,5-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 114200459 |
| Molecular Formula | C14H20F2O |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3,5-dimethylhexan-1-ol |
| SMILES | CC(C)CC(C)CC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H20F2O/c1-9(2)6-10(3)7-14(17)12-8-11(15)4-5-13(12)16/h4-5,8-10,14,17H,6-7H2,1-3H3 |
| InChIKey | FTLBDUBAVVRFRV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |