C16H28OSSi — CID 12061429
tert-butyl-dimethyl-[1-(4-methylphenyl)sulfanylpropan-2-yloxy]silane (PubChem CID 12061429) has the molecular formula C16H28OSSi and a molecular weight of 296.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(4-methylphenyl)sulfanylpropan-2-yloxy]silane.
| Compound Name | tert-butyl-dimethyl-[1-(4-methylphenyl)sulfanylpropan-2-yloxy]silane |
|---|---|
| PubChem CID | 12061429 |
| Molecular Formula | C16H28OSSi |
| Molecular Weight | 296.55 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl-dimethyl-[1-(4-methylphenyl)sulfanylpropan-2-yloxy]silane |
| SMILES | Cc1ccc(SCC(C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28OSSi/c1-13-8-10-15(11-9-13)18-12-14(2)17-19(6,7)16(3,4)5/h8-11,14H,12H2,1-7H3 |
| InChIKey | KUHNHMYLCQSYRO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|