C14H15N3O2 — CID 107789170
ethyl 3-(3,4-dicyanoanilino)-2-methylpropanoate (PubChem CID 107789170) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 3-(3,4-dicyanoanilino)-2-methylpropanoate.
| Compound Name | ethyl 3-(3,4-dicyanoanilino)-2-methylpropanoate |
|---|---|
| PubChem CID | 107789170 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | ethyl 3-(3,4-dicyanoanilino)-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)CNc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C14H15N3O2/c1-3-19-14(18)10(2)9-17-13-5-4-11(7-15)12(6-13)8-16/h4-6,10,17H,3,9H2,1-2H3 |
| InChIKey | PCUJBDRKPQVOLY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |