C13H14N4O — CID 107790450
N-(3,4-dicyanophenyl)-2-methyl-3-(methylamino)propanamide (PubChem CID 107790450) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-(3,4-dicyanophenyl)-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 107790450 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(3,4-dicyanophenyl)-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H14N4O/c1-9(8-16-2)13(18)17-12-4-3-10(6-14)11(5-12)7-15/h3-5,9,16H,8H2,1-2H3,(H,17,18) |
| InChIKey | JWDNEOOPMZCGCH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |