C12H12N4O — CID 107790511
(2S)-2-amino-N-(3,4-dicyanophenyl)butanamide (PubChem CID 107790511) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,4-dicyanophenyl)butanamide.
| Compound Name | (2S)-2-amino-N-(3,4-dicyanophenyl)butanamide |
|---|---|
| PubChem CID | 107790511 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2S)-2-amino-N-(3,4-dicyanophenyl)butanamide |
| SMILES | CC[C@H](N)C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C12H12N4O/c1-2-11(15)12(17)16-10-4-3-8(6-13)9(5-10)7-14/h3-5,11H,2,15H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | XQBVGIMGWTWEKB-NSHDSACASA-N |
| XLogP | 1.11 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |