2-acetamido-3-(3,4-dicyanoanilino)propanoic acid

C13H12N4O3 — CID 107789426

IUPAC2-acetamido-3-(3,4-dicyanoanilino)propanoic acid
SMILESCC(=O)NC(CNc1ccc(C#N)c(C#N)c1)C(=O)O
InChIInChI=1S/C13H12N4O3/c1-8(18)17-12(13(19)20)7-16-11-3-2-9(5-14)10(4-11)6-15/h2-4,12,16H,7H2,1H3,(H,17,18)(H,19,20)
InChIKeyUZOQRRHREPJUTQ-UHFFFAOYSA-N
MW272.26 g/mol
LogP0.43
Rot. Bonds5

About 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid

2-acetamido-3-(3,4-dicyanoanilino)propanoic acid (PubChem CID 107789426) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(3,4-dicyanoanilino)propanoic acid
PubChem CID107789426
Molecular FormulaC13H12N4O3
Molecular Weight272.26 g/mol
Exact Mass272.09
IUPAC Name2-acetamido-3-(3,4-dicyanoanilino)propanoic acid
SMILESCC(=O)NC(CNc1ccc(C#N)c(C#N)c1)C(=O)O
InChIInChI=1S/C13H12N4O3/c1-8(18)17-12(13(19)20)7-16-11-3-2-9(5-14)10(4-11)6-15/h2-4,12,16H,7H2,1H3,(H,17,18)(H,19,20)
InChIKeyUZOQRRHREPJUTQ-UHFFFAOYSA-N
XLogP0.43
TPSA126.01 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.26
LogP ≤ 50.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid?
The IUPAC name of 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid (CID 107789426) is 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid?
The canonical SMILES for 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid is CC(=O)NC(CNc1ccc(C#N)c(C#N)c1)C(=O)O.
What is the InChIKey of 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid?
The InChIKey is UZOQRRHREPJUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O3/c1-8(18)17-12(13(19)20)7-16-11-3-2-9(5-14)10(4-11)6-15/h2-4,12,16H,7H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid?
2-acetamido-3-(3,4-dicyanoanilino)propanoic acid has a molecular weight of 272.26 g/mol, XLogP of 0.43, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(3,4-dicyanoanilino)propanoic acid is sourced from PubChem (CID 107789426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).