C13H12N4O4 — CID 107792067
2-[(3,4-dicyanophenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107792067) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-[(3,4-dicyanophenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(3,4-dicyanophenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107792067 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[(3,4-dicyanophenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | N#Cc1ccc(NC(=O)NC(CCO)C(=O)O)cc1C#N |
| InChI | InChI=1S/C13H12N4O4/c14-6-8-1-2-10(5-9(8)7-15)16-13(21)17-11(3-4-18)12(19)20/h1-2,5,11,18H,3-4H2,(H,19,20)(H2,16,17,21) |
| InChIKey | CXSHSVPYOLPIDD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 146.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |