C13H15N3O4 — CID 107827481
(2S)-2-[[4-(cyanomethyl)phenyl]carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107827481) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2S)-2-[[4-(cyanomethyl)phenyl]carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[4-(cyanomethyl)phenyl]carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107827481 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2S)-2-[[4-(cyanomethyl)phenyl]carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | N#CCc1ccc(NC(=O)N[C@@H](CCO)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15N3O4/c14-7-5-9-1-3-10(4-2-9)15-13(20)16-11(6-8-17)12(18)19/h1-4,11,17H,5-6,8H2,(H,18,19)(H2,15,16,20)/t11-/m0/s1 |
| InChIKey | SAIZCAOSQNWOCC-NSHDSACASA-N |
| XLogP | 0.71 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |