C14H14N4O4 — CID 141047915
1-[2-(3,4-dicyanoanilino)acetyl]oxyethyl 2-aminoacetate (PubChem CID 141047915) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-[2-(3,4-dicyanoanilino)acetyl]oxyethyl 2-aminoacetate.
| Compound Name | 1-[2-(3,4-dicyanoanilino)acetyl]oxyethyl 2-aminoacetate |
|---|---|
| PubChem CID | 141047915 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[2-(3,4-dicyanoanilino)acetyl]oxyethyl 2-aminoacetate |
| SMILES | CC(OC(=O)CN)OC(=O)CNc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C14H14N4O4/c1-9(21-13(19)7-17)22-14(20)8-18-12-3-2-10(5-15)11(4-12)6-16/h2-4,9,18H,7-8,17H2,1H3 |
| InChIKey | ZSKIZBZWGYVWAO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|