C13H11N5O — CID 107789307
N-(2-cyanoethyl)-2-(3,4-dicyanoanilino)acetamide (PubChem CID 107789307) has the molecular formula C13H11N5O and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3,4-dicyanoanilino)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(3,4-dicyanoanilino)acetamide |
|---|---|
| PubChem CID | 107789307 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3,4-dicyanoanilino)acetamide |
| SMILES | N#CCCNC(=O)CNc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H11N5O/c14-4-1-5-17-13(19)9-18-12-3-2-10(7-15)11(6-12)8-16/h2-3,6,18H,1,5,9H2,(H,17,19) |
| InChIKey | QOXZDBFCLUECMM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|