C14H14N4O — CID 67011238
N-(cyclopropylmethyl)-2-(3,4-dicyanoanilino)acetamide (PubChem CID 67011238) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(3,4-dicyanoanilino)acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(3,4-dicyanoanilino)acetamide |
|---|---|
| PubChem CID | 67011238 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(3,4-dicyanoanilino)acetamide |
| SMILES | N#Cc1ccc(NCC(=O)NCC2CC2)cc1C#N |
| InChI | InChI=1S/C14H14N4O/c15-6-11-3-4-13(5-12(11)7-16)17-9-14(19)18-8-10-1-2-10/h3-5,10,17H,1-2,8-9H2,(H,18,19) |
| InChIKey | XTIMEWQGLFPRMD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |