C11H11ClFN3O — CID 103773178
2-(3-chloro-5-fluoroanilino)-N-(2-cyanoethyl)acetamide (PubChem CID 103773178) has the molecular formula C11H11ClFN3O and a molecular weight of 255.68 g/mol. Its IUPAC name is 2-(3-chloro-5-fluoroanilino)-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(3-chloro-5-fluoroanilino)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 103773178 |
| Molecular Formula | C11H11ClFN3O |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-(3-chloro-5-fluoroanilino)-N-(2-cyanoethyl)acetamide |
| SMILES | N#CCCNC(=O)CNc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C11H11ClFN3O/c12-8-4-9(13)6-10(5-8)16-7-11(17)15-3-1-2-14/h4-6,16H,1,3,7H2,(H,15,17) |
| InChIKey | KUFHARPRBSIFPS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|