C18H27N5 — CID 69450838
4-N-[2-[2-(4-amino-3-methylanilino)ethylamino]ethyl]-2-methylbenzene-1,4-diamine (PubChem CID 69450838) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-N-[2-[2-(4-amino-3-methylanilino)ethylamino]ethyl]-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[2-[2-(4-amino-3-methylanilino)ethylamino]ethyl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 69450838 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 4-N-[2-[2-(4-amino-3-methylanilino)ethylamino]ethyl]-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(NCCNCCNc2ccc(N)c(C)c2)ccc1N |
| InChI | InChI=1S/C18H27N5/c1-13-11-15(3-5-17(13)19)22-9-7-21-8-10-23-16-4-6-18(20)14(2)12-16/h3-6,11-12,21-23H,7-10,19-20H2,1-2H3 |
| InChIKey | PLNYZXLFLSYCSK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|