C11H18N2O — CID 88803762
4-N-ethyl-2-methylbenzene-1,4-diamine;oxirane (PubChem CID 88803762) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N-ethyl-2-methylbenzene-1,4-diamine;oxirane.
| Compound Name | 4-N-ethyl-2-methylbenzene-1,4-diamine;oxirane |
|---|---|
| PubChem CID | 88803762 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-N-ethyl-2-methylbenzene-1,4-diamine;oxirane |
| SMILES | C1CO1.CCNc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C9H14N2.C2H4O/c1-3-11-8-4-5-9(10)7(2)6-8;1-2-3-1/h4-6,11H,3,10H2,1-2H3;1-2H2 |
| InChIKey | JNELSYHHXNDGFC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|