C12H18N2 — CID 131239425
2-methyl-4-N-[(E)-pent-2-enyl]benzene-1,4-diamine (PubChem CID 131239425) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-methyl-4-N-[(E)-pent-2-enyl]benzene-1,4-diamine.
| Compound Name | 2-methyl-4-N-[(E)-pent-2-enyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 131239425 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-methyl-4-N-[(E)-pent-2-enyl]benzene-1,4-diamine |
| SMILES | CC/C=C/CNc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C12H18N2/c1-3-4-5-8-14-11-6-7-12(13)10(2)9-11/h4-7,9,14H,3,8,13H2,1-2H3/b5-4+ |
| InChIKey | YMIAYUMNVOKJOQ-SNAWJCMRSA-N |
| XLogP | 2.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|