C11H17N3 — CID 131246902
4-N-[(E)-pent-2-enyl]benzene-1,2,4-triamine (PubChem CID 131246902) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 4-N-[(E)-pent-2-enyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[(E)-pent-2-enyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 131246902 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 4-N-[(E)-pent-2-enyl]benzene-1,2,4-triamine |
| SMILES | CC/C=C/CNc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C11H17N3/c1-2-3-4-7-14-9-5-6-10(12)11(13)8-9/h3-6,8,14H,2,7,12-13H2,1H3/b4-3+ |
| InChIKey | ZHAGVJTVFJFSJU-ONEGZZNKSA-N |
| XLogP | 2.23 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|