C10H17N3O2 — CID 106750959
3-(3,4-diaminoanilino)-2-methylpropane-1,2-diol (PubChem CID 106750959) has the molecular formula C10H17N3O2 and a molecular weight of 211.27 g/mol. Its IUPAC name is 3-(3,4-diaminoanilino)-2-methylpropane-1,2-diol.
| Compound Name | 3-(3,4-diaminoanilino)-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 106750959 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-(3,4-diaminoanilino)-2-methylpropane-1,2-diol |
| SMILES | CC(O)(CO)CNc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C10H17N3O2/c1-10(15,6-14)5-13-7-2-3-8(11)9(12)4-7/h2-4,13-15H,5-6,11-12H2,1H3 |
| InChIKey | ZNEUWXGWBZBREL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|