C11H19N3O — CID 106751189
1-(3,4-diaminoanilino)pentan-2-ol (PubChem CID 106751189) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(3,4-diaminoanilino)pentan-2-ol.
| Compound Name | 1-(3,4-diaminoanilino)pentan-2-ol |
|---|---|
| PubChem CID | 106751189 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(3,4-diaminoanilino)pentan-2-ol |
| SMILES | CCCC(O)CNc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C11H19N3O/c1-2-3-9(15)7-14-8-4-5-10(12)11(13)6-8/h4-6,9,14-15H,2-3,7,12-13H2,1H3 |
| InChIKey | PSSHPQIKNPBJOD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|