C10H17N3OS — CID 106751170
4-N-(2-methylsulfinylpropyl)benzene-1,2,4-triamine (PubChem CID 106751170) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-N-(2-methylsulfinylpropyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(2-methylsulfinylpropyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106751170 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-N-(2-methylsulfinylpropyl)benzene-1,2,4-triamine |
| SMILES | CC(CNc1ccc(N)c(N)c1)S(C)=O |
| InChI | InChI=1S/C10H17N3OS/c1-7(15(2)14)6-13-8-3-4-9(11)10(12)5-8/h3-5,7,13H,6,11-12H2,1-2H3 |
| InChIKey | WVINJUHXUVYDEN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|