C11H19N3 — CID 106750233
4-N-pentan-2-ylbenzene-1,2,4-triamine (PubChem CID 106750233) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-N-pentan-2-ylbenzene-1,2,4-triamine.
| Compound Name | 4-N-pentan-2-ylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750233 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 4-N-pentan-2-ylbenzene-1,2,4-triamine |
| SMILES | CCCC(C)Nc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C11H19N3/c1-3-4-8(2)14-9-5-6-10(12)11(13)7-9/h5-8,14H,3-4,12-13H2,1-2H3 |
| InChIKey | AYRUNRHLOMSUTB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|