C9H14FN3 — CID 126976135
4-N-(3-fluoropropyl)benzene-1,2,4-triamine (PubChem CID 126976135) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-N-(3-fluoropropyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(3-fluoropropyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 126976135 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 4-N-(3-fluoropropyl)benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NCCCF)cc1N |
| InChI | InChI=1S/C9H14FN3/c10-4-1-5-13-7-2-3-8(11)9(12)6-7/h2-3,6,13H,1,4-5,11-12H2 |
| InChIKey | UWSVOJYYCCNXBT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|