C8H10BrFN2 — CID 163404766
2-bromo-4-N-(2-fluoroethyl)benzene-1,4-diamine (PubChem CID 163404766) has the molecular formula C8H10BrFN2 and a molecular weight of 233.08 g/mol. Its IUPAC name is 2-bromo-4-N-(2-fluoroethyl)benzene-1,4-diamine.
| Compound Name | 2-bromo-4-N-(2-fluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 163404766 |
| Molecular Formula | C8H10BrFN2 |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 2-bromo-4-N-(2-fluoroethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCF)cc1Br |
| InChI | InChI=1S/C8H10BrFN2/c9-7-5-6(12-4-3-10)1-2-8(7)11/h1-2,5,12H,3-4,11H2 |
| InChIKey | FUTYXIBXORWTMF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|