C7H10BrN3O2S — CID 114804926
2-bromo-4-N-(methylsulfamoyl)benzene-1,4-diamine (PubChem CID 114804926) has the molecular formula C7H10BrN3O2S and a molecular weight of 280.15 g/mol. Its IUPAC name is 2-bromo-4-N-(methylsulfamoyl)benzene-1,4-diamine.
| Compound Name | 2-bromo-4-N-(methylsulfamoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114804926 |
| Molecular Formula | C7H10BrN3O2S |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 2-bromo-4-N-(methylsulfamoyl)benzene-1,4-diamine |
| SMILES | CNS(=O)(=O)Nc1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C7H10BrN3O2S/c1-10-14(12,13)11-5-2-3-7(9)6(8)4-5/h2-4,10-11H,9H2,1H3 |
| InChIKey | ONCFFKNPXWFOCL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|