C9H14BrN3O3S — CID 114814198
4-bromo-1-N-(2-methoxyethylsulfamoyl)benzene-1,3-diamine (PubChem CID 114814198) has the molecular formula C9H14BrN3O3S and a molecular weight of 324.20 g/mol. Its IUPAC name is 4-bromo-1-N-(2-methoxyethylsulfamoyl)benzene-1,3-diamine.
| Compound Name | 4-bromo-1-N-(2-methoxyethylsulfamoyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114814198 |
| Molecular Formula | C9H14BrN3O3S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 4-bromo-1-N-(2-methoxyethylsulfamoyl)benzene-1,3-diamine |
| SMILES | COCCNS(=O)(=O)Nc1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C9H14BrN3O3S/c1-16-5-4-12-17(14,15)13-7-2-3-8(10)9(11)6-7/h2-3,6,12-13H,4-5,11H2,1H3 |
| InChIKey | SADBLSBDJAOQTO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|