C24H42N5+ — CID 144516192
3-(4-amino-3-methylanilino)propyl-methyl-propylazanium;2-methyl-4-N-propylbenzene-1,4-diamine (PubChem CID 144516192) has the molecular formula C24H42N5+ and a molecular weight of 400.64 g/mol. Its IUPAC name is 3-(4-amino-3-methylanilino)propyl-methyl-propylazanium;2-methyl-4-N-propylbenzene-1,4-diamine.
| Compound Name | 3-(4-amino-3-methylanilino)propyl-methyl-propylazanium;2-methyl-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 144516192 |
| Molecular Formula | C24H42N5+ |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.34 |
| IUPAC Name | 3-(4-amino-3-methylanilino)propyl-methyl-propylazanium;2-methyl-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCNc1ccc(N)c(C)c1.CCC[NH+](C)CCCNc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C14H25N3.C10H16N2/c1-4-9-17(3)10-5-8-16-13-6-7-14(15)12(2)11-13;1-3-6-12-9-4-5-10(11)8(2)7-9/h6-7,11,16H,4-5,8-10,15H2,1-3H3;4-5,7,12H,3,6,11H2,1-2H3/p+1 |
| InChIKey | RLBGYOPVCPZJBL-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|