C25H43N5 — CID 157300154
bis[3-(4-amino-3-methylanilino)propyl]-methyl-propylazanium;carbanide (PubChem CID 157300154) has the molecular formula C25H43N5 and a molecular weight of 413.65 g/mol. Its IUPAC name is bis[3-(4-amino-3-methylanilino)propyl]-methyl-propylazanium;carbanide.
| Compound Name | bis[3-(4-amino-3-methylanilino)propyl]-methyl-propylazanium;carbanide |
|---|---|
| PubChem CID | 157300154 |
| Molecular Formula | C25H43N5 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | bis[3-(4-amino-3-methylanilino)propyl]-methyl-propylazanium;carbanide |
| SMILES | CCC[N+](C)(CCCNc1ccc(N)c(C)c1)CCCNc1ccc(N)c(C)c1.[CH3-] |
| InChI | InChI=1S/C24H40N5.CH3/c1-5-14-29(4,15-6-12-27-21-8-10-23(25)19(2)17-21)16-7-13-28-22-9-11-24(26)20(3)18-22;/h8-11,17-18,27-28H,5-7,12-16,25-26H2,1-4H3;1H3/q+1;-1 |
| InChIKey | BBUNOOGBXRHKSU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|