C23H37N5 — CID 158032787
bis[2-(4-amino-3-methylanilino)ethyl]-methyl-prop-2-enylazanium;carbanide (PubChem CID 158032787) has the molecular formula C23H37N5 and a molecular weight of 383.58 g/mol. Its IUPAC name is bis[2-(4-amino-3-methylanilino)ethyl]-methyl-prop-2-enylazanium;carbanide.
| Compound Name | bis[2-(4-amino-3-methylanilino)ethyl]-methyl-prop-2-enylazanium;carbanide |
|---|---|
| PubChem CID | 158032787 |
| Molecular Formula | C23H37N5 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | bis[2-(4-amino-3-methylanilino)ethyl]-methyl-prop-2-enylazanium;carbanide |
| SMILES | C=CC[N+](C)(CCNc1ccc(N)c(C)c1)CCNc1ccc(N)c(C)c1.[CH3-] |
| InChI | InChI=1S/C22H34N5.CH3/c1-5-12-27(4,13-10-25-19-6-8-21(23)17(2)15-19)14-11-26-20-7-9-22(24)18(3)16-20;/h5-9,15-16,25-26H,1,10-14,23-24H2,2-4H3;1H3/q+1;-1 |
| InChIKey | FHJNTIHMHSKZSQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|