C11H14BrF2N — CID 65468335
4-bromo-2,6-difluoro-N-(2-methylbutyl)aniline (PubChem CID 65468335) has the molecular formula C11H14BrF2N and a molecular weight of 278.14 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(2-methylbutyl)aniline.
| Compound Name | 4-bromo-2,6-difluoro-N-(2-methylbutyl)aniline |
|---|---|
| PubChem CID | 65468335 |
| Molecular Formula | C11H14BrF2N |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(2-methylbutyl)aniline |
| SMILES | CCC(C)CNc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H14BrF2N/c1-3-7(2)6-15-11-9(13)4-8(12)5-10(11)14/h4-5,7,15H,3,6H2,1-2H3 |
| InChIKey | QVIPHPUYIPESKL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |