C14H19BrF2 — CID 167507433
5-bromo-1,3-difluoro-2-octylbenzene (PubChem CID 167507433) has the molecular formula C14H19BrF2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-2-octylbenzene.
| Compound Name | 5-bromo-1,3-difluoro-2-octylbenzene |
|---|---|
| PubChem CID | 167507433 |
| Molecular Formula | C14H19BrF2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-bromo-1,3-difluoro-2-octylbenzene |
| SMILES | CCCCCCCCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H19BrF2/c1-2-3-4-5-6-7-8-12-13(16)9-11(15)10-14(12)17/h9-10H,2-8H2,1H3 |
| InChIKey | ULIVJZMAKLWHOT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|