C16H24F2 — CID 138738043
1,3-difluoro-2,5-dipentylbenzene (PubChem CID 138738043) has the molecular formula C16H24F2 and a molecular weight of 254.36 g/mol. Its IUPAC name is 1,3-difluoro-2,5-dipentylbenzene.
| Compound Name | 1,3-difluoro-2,5-dipentylbenzene |
|---|---|
| PubChem CID | 138738043 |
| Molecular Formula | C16H24F2 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1,3-difluoro-2,5-dipentylbenzene |
| SMILES | CCCCCc1cc(F)c(CCCCC)c(F)c1 |
| InChI | InChI=1S/C16H24F2/c1-3-5-7-9-13-11-15(17)14(16(18)12-13)10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | OZUGXIDPOOGQSL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|