C14H22F2Si — CID 15751979
(2,6-difluoro-4-pentylphenyl)-trimethylsilane (PubChem CID 15751979) has the molecular formula C14H22F2Si and a molecular weight of 256.41 g/mol. Its IUPAC name is (2,6-difluoro-4-pentylphenyl)-trimethylsilane.
| Compound Name | (2,6-difluoro-4-pentylphenyl)-trimethylsilane |
|---|---|
| PubChem CID | 15751979 |
| Molecular Formula | C14H22F2Si |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2,6-difluoro-4-pentylphenyl)-trimethylsilane |
| SMILES | CCCCCc1cc(F)c([Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C14H22F2Si/c1-5-6-7-8-11-9-12(15)14(13(16)10-11)17(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | MFHBDTHKNMXXBD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|