C16H23BF2O2 — CID 67648574
2-(2,6-difluoro-4-pentylphenyl)-5-ethyl-1,3,2-dioxaborinane (PubChem CID 67648574) has the molecular formula C16H23BF2O2 and a molecular weight of 296.17 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-pentylphenyl)-5-ethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(2,6-difluoro-4-pentylphenyl)-5-ethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 67648574 |
| Molecular Formula | C16H23BF2O2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-(2,6-difluoro-4-pentylphenyl)-5-ethyl-1,3,2-dioxaborinane |
| SMILES | CCCCCc1cc(F)c(B2OCC(CC)CO2)c(F)c1 |
| InChI | InChI=1S/C16H23BF2O2/c1-3-5-6-7-13-8-14(18)16(15(19)9-13)17-20-10-12(4-2)11-21-17/h8-9,12H,3-7,10-11H2,1-2H3 |
| InChIKey | QOLIEMFMPPJJSW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|