C21H28F4O2 — CID 118358995
5-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-2-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118358995) has the molecular formula C21H28F4O2 and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-2-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 5-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-2-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118358995 |
| Molecular Formula | C21H28F4O2 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-2-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1CCC(CCCCc2cc(F)c(OC(F)F)c(F)c2)=CO1 |
| InChI | InChI=1S/C21H28F4O2/c1-2-3-4-9-17-11-10-15(14-26-17)7-5-6-8-16-12-18(22)20(19(23)13-16)27-21(24)25/h12-14,17,21H,2-11H2,1H3 |
| InChIKey | GTQIXVDDXFPFJF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|