C19H27F4IOSi — CID 67744713
4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-1-iodo-1-propylsilinane (PubChem CID 67744713) has the molecular formula C19H27F4IOSi and a molecular weight of 502.41 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-1-iodo-1-propylsilinane.
| Compound Name | 4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-1-iodo-1-propylsilinane |
|---|---|
| PubChem CID | 67744713 |
| Molecular Formula | C19H27F4IOSi |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 4-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]butyl]-1-iodo-1-propylsilinane |
| SMILES | CCC[Si]1(I)CCC(CCCCc2cc(F)c(OC(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H27F4IOSi/c1-2-9-26(24)10-7-14(8-11-26)5-3-4-6-15-12-16(20)18(17(21)13-15)25-19(22)23/h12-14,19H,2-11H2,1H3 |
| InChIKey | ZOVRHLJSRLUTAQ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|