C22H32F4OSi — CID 139675571
3-[4-(difluoromethoxy)-3,5-difluorophenyl]-9-pentyl-6-silaspiro[5.5]undecane (PubChem CID 139675571) has the molecular formula C22H32F4OSi and a molecular weight of 416.58 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3,5-difluorophenyl]-9-pentyl-6-silaspiro[5.5]undecane.
| Compound Name | 3-[4-(difluoromethoxy)-3,5-difluorophenyl]-9-pentyl-6-silaspiro[5.5]undecane |
|---|---|
| PubChem CID | 139675571 |
| Molecular Formula | C22H32F4OSi |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3,5-difluorophenyl]-9-pentyl-6-silaspiro[5.5]undecane |
| SMILES | CCCCCC1CC[Si]2(CC1)CCC(c1cc(F)c(OC(F)F)c(F)c1)CC2 |
| InChI | InChI=1S/C22H32F4OSi/c1-2-3-4-5-16-6-10-28(11-7-16)12-8-17(9-13-28)18-14-19(23)21(20(24)15-18)27-22(25)26/h14-17,22H,2-13H2,1H3 |
| InChIKey | BQTVOAZZODQZDG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|