C27H38F4O — CID 67589935
2-(difluoromethoxy)-1,3-difluoro-5-[4-[4-[(E)-oct-5-enyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 67589935) has the molecular formula C27H38F4O and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,3-difluoro-5-[4-[4-[(E)-oct-5-enyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-[4-[(E)-oct-5-enyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 67589935 |
| Molecular Formula | C27H38F4O |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-[4-[(E)-oct-5-enyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CC/C=C/CCCCC1CCC(C2CCC(c3cc(F)c(OC(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H38F4O/c1-2-3-4-5-6-7-8-19-9-11-20(12-10-19)21-13-15-22(16-14-21)23-17-24(28)26(25(29)18-23)32-27(30)31/h3-4,17-22,27H,2,5-16H2,1H3/b4-3+ |
| InChIKey | IDCIGWPEYDIPJH-ONEGZZNKSA-N |
| XLogP | 9.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|