C29H40F4O2 — CID 118359057
5-[4-(difluoromethoxy)-3,5-difluorophenyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydro-2H-pyran (PubChem CID 118359057) has the molecular formula C29H40F4O2 and a molecular weight of 496.63 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)-3,5-difluorophenyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydro-2H-pyran.
| Compound Name | 5-[4-(difluoromethoxy)-3,5-difluorophenyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118359057 |
| Molecular Formula | C29H40F4O2 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 5-[4-(difluoromethoxy)-3,5-difluorophenyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(c4cc(F)c(OC(F)F)c(F)c4)=CO3)CC2)CC1 |
| InChI | InChI=1S/C29H40F4O2/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)27-15-14-23(18-34-27)24-16-25(30)28(26(31)17-24)35-29(32)33/h16-22,27,29H,2-15H2,1H3 |
| InChIKey | OIQSNSWNQQUKDD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|