C31H41F4OSi — CID 23364828
CID 23364828 (PubChem CID 23364828) has the molecular formula C31H41F4OSi and a molecular weight of 533.75 g/mol.
| Compound Name | CID 23364828 |
|---|---|
| PubChem CID | 23364828 |
| Molecular Formula | C31H41F4OSi |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(C2CCC(CCc3ccc(-c4cc(F)c(OC(F)F)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C31H41F4OSi/c1-2-3-4-17-37-18-15-26(16-19-37)24-11-7-22(8-12-24)5-6-23-9-13-25(14-10-23)27-20-28(32)30(29(33)21-27)36-31(34)35/h9-10,13-14,20-22,24,26,31H,2-8,11-12,15-19H2,1H3 |
| InChIKey | MRBCBRCWAVUBNS-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|