C28H45F2OSi — CID 22913746
CID 22913746 (PubChem CID 22913746) has the molecular formula C28H45F2OSi and a molecular weight of 463.75 g/mol.
| Compound Name | CID 22913746 |
|---|---|
| PubChem CID | 22913746 |
| Molecular Formula | C28H45F2OSi |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | — |
| SMILES | CCCCC[Si]1CCC(C2CCC(CCCCc3ccc(OCCF)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H45F2OSi/c1-2-3-6-19-32-20-15-26(16-21-32)25-12-9-23(10-13-25)7-4-5-8-24-11-14-28(27(30)22-24)31-18-17-29/h11,14,22-23,25-26H,2-10,12-13,15-21H2,1H3 |
| InChIKey | BQLSWUPRGLCWSA-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|