C21H21F4IO — CID 162547419
2-(difluoromethoxy)-1,3-difluoro-5-[4-[2-(4-iodocyclohexyl)ethyl]phenyl]benzene (PubChem CID 162547419) has the molecular formula C21H21F4IO and a molecular weight of 492.29 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,3-difluoro-5-[4-[2-(4-iodocyclohexyl)ethyl]phenyl]benzene.
| Compound Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-[2-(4-iodocyclohexyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 162547419 |
| Molecular Formula | C21H21F4IO |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-[2-(4-iodocyclohexyl)ethyl]phenyl]benzene |
| SMILES | Fc1cc(-c2ccc(CCC3CCC(I)CC3)cc2)cc(F)c1OC(F)F |
| InChI | InChI=1S/C21H21F4IO/c22-18-11-16(12-19(23)20(18)27-21(24)25)15-7-3-13(4-8-15)1-2-14-5-9-17(26)10-6-14/h3-4,7-8,11-12,14,17,21H,1-2,5-6,9-10H2 |
| InChIKey | GVUAHCYBVMLIJH-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|