C23H31F — CID 18657028
1-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2-fluoro-4-pentylbenzene (PubChem CID 18657028) has the molecular formula C23H31F and a molecular weight of 326.50 g/mol. Its IUPAC name is 1-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2-fluoro-4-pentylbenzene.
| Compound Name | 1-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2-fluoro-4-pentylbenzene |
|---|---|
| PubChem CID | 18657028 |
| Molecular Formula | C23H31F |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-2-fluoro-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C#C/C=C/C2CCC(CC)CC2)c(F)c1 |
| InChI | InChI=1S/C23H31F/c1-3-5-6-10-21-16-17-22(23(24)18-21)11-8-7-9-20-14-12-19(4-2)13-15-20/h7,9,16-20H,3-6,10,12-15H2,1-2H3/b9-7+ |
| InChIKey | LPXFKPJBXUEUMY-VQHVLOKHSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|