C14H18F4 — CID 20653964
2-(difluoromethyl)-1,3-difluoro-5-heptylbenzene (PubChem CID 20653964) has the molecular formula C14H18F4 and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-difluoro-5-heptylbenzene.
| Compound Name | 2-(difluoromethyl)-1,3-difluoro-5-heptylbenzene |
|---|---|
| PubChem CID | 20653964 |
| Molecular Formula | C14H18F4 |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(difluoromethyl)-1,3-difluoro-5-heptylbenzene |
| SMILES | CCCCCCCc1cc(F)c(C(F)F)c(F)c1 |
| InChI | InChI=1S/C14H18F4/c1-2-3-4-5-6-7-10-8-11(15)13(14(17)18)12(16)9-10/h8-9,14H,2-7H2,1H3 |
| InChIKey | BBHZWNGVXMSBDS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|