C14H19BF2O2 — CID 54202924
2-(3,4-difluorophenyl)-5-pentyl-1,3,2-dioxaborinane (PubChem CID 54202924) has the molecular formula C14H19BF2O2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-pentyl-1,3,2-dioxaborinane.
| Compound Name | 2-(3,4-difluorophenyl)-5-pentyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 54202924 |
| Molecular Formula | C14H19BF2O2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-pentyl-1,3,2-dioxaborinane |
| SMILES | CCCCCC1COB(c2ccc(F)c(F)c2)OC1 |
| InChI | InChI=1S/C14H19BF2O2/c1-2-3-4-5-11-9-18-15(19-10-11)12-6-7-13(16)14(17)8-12/h6-8,11H,2-5,9-10H2,1H3 |
| InChIKey | PQNBFUQRMRNACV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|